3-Fluoro-DL-phenylalanine
Catalog No: FT-0694630
CAS No: 456-88-2
- Chemical Name: 3-Fluoro-DL-phenylalanine
- Molecular Formula: C9H10FNO2
- Molecular Weight: 183.18
- InChI Key: VWHRYODZTDMVSS-UHFFFAOYSA-N
- InChI: InChI=1S/C9H10FNO2/c10-7-3-1-2-6(4-7)5-8(11)9(12)13/h1-4,8H,5,11H2,(H,12,13)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | -240ºC(dec.) |
|---|---|
| CAS: | 456-88-2 |
| MF: | C9H10FNO2 |
| Flash_Point: | 138.3±25.1 °C |
| Product_Name: | 3-Fluoro-DL-phenylalanine |
| Density: | 1.3±0.1 g/cm3 |
| FW: | 183.180 |
| Bolling_Point: | 305.0±32.0 °C at 760 mmHg |
| Melting_Point: | -240ºC(dec.) |
|---|---|
| Refractive_Index: | 1.555 |
| Vapor_Pressure: | 0.0±0.7 mmHg at 25°C |
| MF: | C9H10FNO2 |
| Flash_Point: | 138.3±25.1 °C |
| LogP: | 1.16 |
| FW: | 183.180 |
| Density: | 1.3±0.1 g/cm3 |
| PSA: | 63.32000 |
| Bolling_Point: | 305.0±32.0 °C at 760 mmHg |
| Exact_Mass: | 183.069550 |
| Risk_Statements(EU): | R37 |
|---|---|
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi: Irritant; |
| HS_Code: | 2922499990 |
| Safety_Statements: | 24/25 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)